C6H5ClN2S — CID 22065996
2-(chloromethyl)-1H-thieno[3,4-d]imidazole (PubChem CID 22065996) has the molecular formula C6H5ClN2S and a molecular weight of 172.64 g/mol. Its IUPAC name is 2-(chloromethyl)-1H-thieno[3,4-d]imidazole.
| Compound Name | 2-(chloromethyl)-1H-thieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 22065996 |
| Molecular Formula | C6H5ClN2S |
| Molecular Weight | 172.64 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 2-(chloromethyl)-1H-thieno[3,4-d]imidazole |
| SMILES | ClCc1nc2cscc2[nH]1 |
| InChI | InChI=1S/C6H5ClN2S/c7-1-6-8-4-2-10-3-5(4)9-6/h2-3H,1H2,(H,8,9) |
| InChIKey | YJDRLCROQGISEE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.64 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|