C8H5ClI2N2 — CID 118176409
2-(chloromethyl)-5,6-diiodo-1H-benzimidazole (PubChem CID 118176409) has the molecular formula C8H5ClI2N2 and a molecular weight of 418.40 g/mol. Its IUPAC name is 2-(chloromethyl)-5,6-diiodo-1H-benzimidazole.
| Compound Name | 2-(chloromethyl)-5,6-diiodo-1H-benzimidazole |
|---|---|
| PubChem CID | 118176409 |
| Molecular Formula | C8H5ClI2N2 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 417.82 |
| IUPAC Name | 2-(chloromethyl)-5,6-diiodo-1H-benzimidazole |
| SMILES | ClCc1nc2cc(I)c(I)cc2[nH]1 |
| InChI | InChI=1S/C8H5ClI2N2/c9-3-8-12-6-1-4(10)5(11)2-7(6)13-8/h1-2H,3H2,(H,12,13) |
| InChIKey | MPSVMZHENYLBPZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|