C8H7ClN2 — CID 162702140
2-(chloromethyl)-4,5,6,7-tetradeuterio-1H-benzimidazole (PubChem CID 162702140) has the molecular formula C8H7ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 2-(chloromethyl)-4,5,6,7-tetradeuterio-1H-benzimidazole.
| Compound Name | 2-(chloromethyl)-4,5,6,7-tetradeuterio-1H-benzimidazole |
|---|---|
| PubChem CID | 162702140 |
| Molecular Formula | C8H7ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-(chloromethyl)-4,5,6,7-tetradeuterio-1H-benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2[nH]c(CCl)nc2c1[2H] |
| InChI | InChI=1S/C8H7ClN2/c9-5-8-10-6-3-1-2-4-7(6)11-8/h1-4H,5H2,(H,10,11)/i1D,2D,3D,4D |
| InChIKey | SPMLMLQATWNZEE-RHQRLBAQSA-N |
| XLogP | 2.30 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|