C8H5Br2ClN2 — CID 11174733
4,6-dibromo-2-(chloromethyl)-1H-benzimidazole (PubChem CID 11174733) has the molecular formula C8H5Br2ClN2 and a molecular weight of 324.40 g/mol. Its IUPAC name is 4,6-dibromo-2-(chloromethyl)-1H-benzimidazole.
| Compound Name | 4,6-dibromo-2-(chloromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 11174733 |
| Molecular Formula | C8H5Br2ClN2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 321.85 |
| IUPAC Name | 4,6-dibromo-2-(chloromethyl)-1H-benzimidazole |
| SMILES | ClCc1nc2c(Br)cc(Br)cc2[nH]1 |
| InChI | InChI=1S/C8H5Br2ClN2/c9-4-1-5(10)8-6(2-4)12-7(3-11)13-8/h1-2H,3H2,(H,12,13) |
| InChIKey | XZFVFGWVVMMZDU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|