C14H19ClN2 — CID 91291350
2-(chloromethyl)-6-(4-methylpentyl)-1H-benzimidazole (PubChem CID 91291350) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 2-(chloromethyl)-6-(4-methylpentyl)-1H-benzimidazole.
| Compound Name | 2-(chloromethyl)-6-(4-methylpentyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 91291350 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(chloromethyl)-6-(4-methylpentyl)-1H-benzimidazole |
| SMILES | CC(C)CCCc1ccc2nc(CCl)[nH]c2c1 |
| InChI | InChI=1S/C14H19ClN2/c1-10(2)4-3-5-11-6-7-12-13(8-11)17-14(9-15)16-12/h6-8,10H,3-5,9H2,1-2H3,(H,16,17) |
| InChIKey | XALVEFBHBXTBOG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|