C14H20ClN3 — CID 82337147
N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-methylbutan-1-amine (PubChem CID 82337147) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-methylbutan-1-amine.
| Compound Name | N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 82337147 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-[2-(6-chloro-1H-benzimidazol-2-yl)ethyl]-3-methylbutan-1-amine |
| SMILES | CC(C)CCNCCc1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C14H20ClN3/c1-10(2)5-7-16-8-6-14-17-12-4-3-11(15)9-13(12)18-14/h3-4,9-10,16H,5-8H2,1-2H3,(H,17,18) |
| InChIKey | GMTICSYXFOSMKR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|