C11H14ClN3 — CID 64725128
2-(6-chloro-1H-benzimidazol-2-yl)-N,N-dimethylethanamine (PubChem CID 64725128) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 2-(6-chloro-1H-benzimidazol-2-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(6-chloro-1H-benzimidazol-2-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 64725128 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-(6-chloro-1H-benzimidazol-2-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C11H14ClN3/c1-15(2)6-5-11-13-9-4-3-8(12)7-10(9)14-11/h3-4,7H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | WFAPLSMDXWYORX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |