C14H23N5 — CID 63693003
N'-[2-(6-amino-1H-benzimidazol-2-yl)ethyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 63693003) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N'-[2-(6-amino-1H-benzimidazol-2-yl)ethyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[2-(6-amino-1H-benzimidazol-2-yl)ethyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63693003 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N'-[2-(6-amino-1H-benzimidazol-2-yl)ethyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)CCc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C14H23N5/c1-18(2)8-9-19(3)7-6-14-16-12-5-4-11(15)10-13(12)17-14/h4-5,10H,6-9,15H2,1-3H3,(H,16,17) |
| InChIKey | YRZMYLGDRIUNOK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|