C11H15N3 — CID 23301932
2-butyl-3H-benzimidazol-5-amine (PubChem CID 23301932) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-butyl-3H-benzimidazol-5-amine.
| Compound Name | 2-butyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 23301932 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-butyl-3H-benzimidazol-5-amine |
| SMILES | CCCCc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C11H15N3/c1-2-3-4-11-13-9-6-5-8(12)7-10(9)14-11/h5-7H,2-4,12H2,1H3,(H,13,14) |
| InChIKey | QWQYWLVNKZCGIM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|