C15H14ClN3 — CID 4080442
2-[2-(4-chlorophenyl)ethyl]-3H-benzimidazol-5-amine (PubChem CID 4080442) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[2-(4-chlorophenyl)ethyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 4080442 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethyl]-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(CCc3ccc(Cl)cc3)[nH]c2c1 |
| InChI | InChI=1S/C15H14ClN3/c16-11-4-1-10(2-5-11)3-8-15-18-13-7-6-12(17)9-14(13)19-15/h1-2,4-7,9H,3,8,17H2,(H,18,19) |
| InChIKey | XYPQTPXDSBANBQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|