C16H15Cl2N3O2-2 — CID 43829299
2-[2-(4-aminophenyl)ethyl]-3H-benzimidazole-5-carboxylic acid dichloride (PubChem CID 43829299) has the molecular formula C16H15Cl2N3O2-2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)ethyl]-3H-benzimidazole-5-carboxylic acid dichloride.
| Compound Name | 2-[2-(4-aminophenyl)ethyl]-3H-benzimidazole-5-carboxylic acid dichloride |
|---|---|
| PubChem CID | 43829299 |
| Molecular Formula | C16H15Cl2N3O2-2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-[2-(4-aminophenyl)ethyl]-3H-benzimidazole-5-carboxylic acid dichloride |
| SMILES | Nc1ccc(CCc2nc3ccc(C(=O)O)cc3[nH]2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C16H15N3O2.2ClH/c17-12-5-1-10(2-6-12)3-8-15-18-13-7-4-11(16(20)21)9-14(13)19-15;;/h1-2,4-7,9H,3,8,17H2,(H,18,19)(H,20,21);2*1H/p-2 |
| InChIKey | TVCDUVBTPGQJJR-UHFFFAOYSA-L |
| XLogP | -3.36 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|