C15H13Cl2N3O2-2 — CID 43829287
2-[(4-aminophenyl)methyl]-3H-benzimidazole-5-carboxylic acid dichloride (PubChem CID 43829287) has the molecular formula C15H13Cl2N3O2-2 and a molecular weight of 338.19 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl]-3H-benzimidazole-5-carboxylic acid dichloride.
| Compound Name | 2-[(4-aminophenyl)methyl]-3H-benzimidazole-5-carboxylic acid dichloride |
|---|---|
| PubChem CID | 43829287 |
| Molecular Formula | C15H13Cl2N3O2-2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-[(4-aminophenyl)methyl]-3H-benzimidazole-5-carboxylic acid dichloride |
| SMILES | Nc1ccc(Cc2nc3ccc(C(=O)O)cc3[nH]2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C15H13N3O2.2ClH/c16-11-4-1-9(2-5-11)7-14-17-12-6-3-10(15(19)20)8-13(12)18-14;;/h1-6,8H,7,16H2,(H,17,18)(H,19,20);2*1H/p-2 |
| InChIKey | OYGMLPIAHNFNKM-UHFFFAOYSA-L |
| XLogP | -3.56 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|