C16H11N3O3 — CID 169352881
2-[(4-isocyanatophenyl)methyl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 169352881) has the molecular formula C16H11N3O3 and a molecular weight of 293.28 g/mol. Its IUPAC name is 2-[(4-isocyanatophenyl)methyl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(4-isocyanatophenyl)methyl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 169352881 |
| Molecular Formula | C16H11N3O3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[(4-isocyanatophenyl)methyl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | O=C=Nc1ccc(Cc2nc3ccc(C(=O)O)cc3[nH]2)cc1 |
| InChI | InChI=1S/C16H11N3O3/c20-9-17-12-4-1-10(2-5-12)7-15-18-13-6-3-11(16(21)22)8-14(13)19-15/h1-6,8H,7H2,(H,18,19)(H,21,22) |
| InChIKey | BTHMSYOGSUTYQC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|