C22H19N3O6 — CID 168537694
2-[[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]methyl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 168537694) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is 2-[[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]methyl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]methyl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 168537694 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl]methyl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc(Cc3nc4ccc(C(=O)O)cc4[nH]3)cc2)C(=O)O1 |
| InChI | InChI=1S/C22H19N3O6/c1-22(2)30-20(28)15(21(29)31-22)11-23-14-6-3-12(4-7-14)9-18-24-16-8-5-13(19(26)27)10-17(16)25-18/h3-8,10-11,23H,9H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | UJTQGRSFHNSKES-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|