C9H11Cl2N3 — CID 46736450
2-(6-chloro-1H-benzimidazol-2-yl)ethanamine;hydrochloride (PubChem CID 46736450) has the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. Its IUPAC name is 2-(6-chloro-1H-benzimidazol-2-yl)ethanamine;hydrochloride.
| Compound Name | 2-(6-chloro-1H-benzimidazol-2-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 46736450 |
| Molecular Formula | C9H11Cl2N3 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 2-(6-chloro-1H-benzimidazol-2-yl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C9H10ClN3.ClH/c10-6-1-2-7-8(5-6)13-9(12-7)3-4-11;/h1-2,5H,3-4,11H2,(H,12,13);1H |
| InChIKey | QGHIEKGLHZSYRT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |