C10H15Cl2N3 — CID 19195701
2-(6-methyl-1H-benzimidazol-2-yl)ethanamine;dihydrochloride (PubChem CID 19195701) has the molecular formula C10H15Cl2N3 and a molecular weight of 248.16 g/mol. Its IUPAC name is 2-(6-methyl-1H-benzimidazol-2-yl)ethanamine;dihydrochloride.
| Compound Name | 2-(6-methyl-1H-benzimidazol-2-yl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 19195701 |
| Molecular Formula | C10H15Cl2N3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-(6-methyl-1H-benzimidazol-2-yl)ethanamine;dihydrochloride |
| SMILES | Cc1ccc2nc(CCN)[nH]c2c1.Cl.Cl |
| InChI | InChI=1S/C10H13N3.2ClH/c1-7-2-3-8-9(6-7)13-10(12-8)4-5-11;;/h2-3,6H,4-5,11H2,1H3,(H,12,13);2*1H |
| InChIKey | NTGJUBKALHXJBB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |