C12H17N3 — CID 45040735
N,N-dimethyl-2-(6-methyl-1H-benzimidazol-2-yl)ethanamine (PubChem CID 45040735) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is N,N-dimethyl-2-(6-methyl-1H-benzimidazol-2-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(6-methyl-1H-benzimidazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 45040735 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N,N-dimethyl-2-(6-methyl-1H-benzimidazol-2-yl)ethanamine |
| SMILES | Cc1ccc2nc(CCN(C)C)[nH]c2c1 |
| InChI | InChI=1S/C12H17N3/c1-9-4-5-10-11(8-9)14-12(13-10)6-7-15(2)3/h4-5,8H,6-7H2,1-3H3,(H,13,14) |
| InChIKey | MNGDPZPGHOCEKY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |