C22H28N2O2 — CID 144710545
ethane;2,3,5-trimethyl-6-[3-(6-methyl-1H-benzimidazol-2-yl)propyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 144710545) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is ethane;2,3,5-trimethyl-6-[3-(6-methyl-1H-benzimidazol-2-yl)propyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | ethane;2,3,5-trimethyl-6-[3-(6-methyl-1H-benzimidazol-2-yl)propyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 144710545 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | ethane;2,3,5-trimethyl-6-[3-(6-methyl-1H-benzimidazol-2-yl)propyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC.CC1=C(C)C(=O)C(CCCc2nc3ccc(C)cc3[nH]2)=C(C)C1=O |
| InChI | InChI=1S/C20H22N2O2.C2H6/c1-11-8-9-16-17(10-11)22-18(21-16)7-5-6-15-14(4)19(23)12(2)13(3)20(15)24;1-2/h8-10H,5-7H2,1-4H3,(H,21,22);1-2H3 |
| InChIKey | TYRDGLLPPMQYAK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|