C20H24N2 — CID 139625761
6-methyl-2-(6-phenylhexyl)-1H-benzimidazole (PubChem CID 139625761) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 6-methyl-2-(6-phenylhexyl)-1H-benzimidazole.
| Compound Name | 6-methyl-2-(6-phenylhexyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 139625761 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 6-methyl-2-(6-phenylhexyl)-1H-benzimidazole |
| SMILES | Cc1ccc2nc(CCCCCCc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C20H24N2/c1-16-13-14-18-19(15-16)22-20(21-18)12-8-3-2-5-9-17-10-6-4-7-11-17/h4,6-7,10-11,13-15H,2-3,5,8-9,12H2,1H3,(H,21,22) |
| InChIKey | POLZOQIXBSHRJF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|