C23H21N3O — CID 46328967
4-methyl-N-[2-(2-phenylethyl)-3H-benzimidazol-5-yl]benzamide (PubChem CID 46328967) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-methyl-N-[2-(2-phenylethyl)-3H-benzimidazol-5-yl]benzamide.
| Compound Name | 4-methyl-N-[2-(2-phenylethyl)-3H-benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 46328967 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-methyl-N-[2-(2-phenylethyl)-3H-benzimidazol-5-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc3nc(CCc4ccccc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C23H21N3O/c1-16-7-10-18(11-8-16)23(27)24-19-12-13-20-21(15-19)26-22(25-20)14-9-17-5-3-2-4-6-17/h2-8,10-13,15H,9,14H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | NOUIFOJZKIVLKF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |