C27H30N4O2 — CID 139827149
4-(diethylamino)-N-[2-[2-(4-methoxyphenyl)ethyl]-3H-benzimidazol-5-yl]benzamide (PubChem CID 139827149) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-(diethylamino)-N-[2-[2-(4-methoxyphenyl)ethyl]-3H-benzimidazol-5-yl]benzamide.
| Compound Name | 4-(diethylamino)-N-[2-[2-(4-methoxyphenyl)ethyl]-3H-benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 139827149 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-(diethylamino)-N-[2-[2-(4-methoxyphenyl)ethyl]-3H-benzimidazol-5-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)Nc2ccc3nc(CCc4ccc(OC)cc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C27H30N4O2/c1-4-31(5-2)22-12-9-20(10-13-22)27(32)28-21-11-16-24-25(18-21)30-26(29-24)17-8-19-6-14-23(33-3)15-7-19/h6-7,9-16,18H,4-5,8,17H2,1-3H3,(H,28,32)(H,29,30) |
| InChIKey | RALUGFQTJPHRKJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |