C16H12F3N3O2 — CID 45494073
4-methoxy-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]benzamide (PubChem CID 45494073) has the molecular formula C16H12F3N3O2 and a molecular weight of 335.29 g/mol. Its IUPAC name is 4-methoxy-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]benzamide.
| Compound Name | 4-methoxy-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 45494073 |
| Molecular Formula | C16H12F3N3O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-methoxy-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3nc(C(F)(F)F)[nH]c3c2)cc1 |
| InChI | InChI=1S/C16H12F3N3O2/c1-24-11-5-2-9(3-6-11)14(23)20-10-4-7-12-13(8-10)22-15(21-12)16(17,18)19/h2-8H,1H3,(H,20,23)(H,21,22) |
| InChIKey | QSENETMEFBFVPR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |