C10H7F3N2O — CID 83450578
1-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]ethanone (PubChem CID 83450578) has the molecular formula C10H7F3N2O and a molecular weight of 228.17 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]ethanone.
| Compound Name | 1-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]ethanone |
|---|---|
| PubChem CID | 83450578 |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]ethanone |
| SMILES | CC(=O)c1ccc2nc(C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C10H7F3N2O/c1-5(16)6-2-3-7-8(4-6)15-9(14-7)10(11,12)13/h2-4H,1H3,(H,14,15) |
| InChIKey | JGIFMBSMJYEGQT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |