C19H16F4N4O — CID 71690227
[4-(4-fluorophenyl)piperazin-1-yl]-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methanone (PubChem CID 71690227) has the molecular formula C19H16F4N4O and a molecular weight of 392.36 g/mol. Its IUPAC name is [4-(4-fluorophenyl)piperazin-1-yl]-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methanone.
| Compound Name | [4-(4-fluorophenyl)piperazin-1-yl]-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 71690227 |
| Molecular Formula | C19H16F4N4O |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [4-(4-fluorophenyl)piperazin-1-yl]-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]methanone |
| SMILES | O=C(c1ccc2nc(C(F)(F)F)[nH]c2c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H16F4N4O/c20-13-2-4-14(5-3-13)26-7-9-27(10-8-26)17(28)12-1-6-15-16(11-12)25-18(24-15)19(21,22)23/h1-6,11H,7-10H2,(H,24,25) |
| InChIKey | XESRESYQDFIXJT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |