C21H22F3N5O2 — CID 55731133
2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide (PubChem CID 55731133) has the molecular formula C21H22F3N5O2 and a molecular weight of 433.43 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide |
|---|---|
| PubChem CID | 55731133 |
| Molecular Formula | C21H22F3N5O2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide |
| SMILES | COc1ccc(N2CCN(CC(=O)Nc3ccc4nc(C(F)(F)F)[nH]c4c3)CC2)cc1 |
| InChI | InChI=1S/C21H22F3N5O2/c1-31-16-5-3-15(4-6-16)29-10-8-28(9-11-29)13-19(30)25-14-2-7-17-18(12-14)27-20(26-17)21(22,23)24/h2-7,12H,8-11,13H2,1H3,(H,25,30)(H,26,27) |
| InChIKey | LELNJLSLIBKXSM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|