C16H20F3N5O — CID 119920132
2-[3-(methylamino)piperidin-1-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide (PubChem CID 119920132) has the molecular formula C16H20F3N5O and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide |
|---|---|
| PubChem CID | 119920132 |
| Molecular Formula | C16H20F3N5O |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-N-[2-(trifluoromethyl)-3H-benzimidazol-5-yl]acetamide |
| SMILES | CNC1CCCN(CC(=O)Nc2ccc3nc(C(F)(F)F)[nH]c3c2)C1 |
| InChI | InChI=1S/C16H20F3N5O/c1-20-11-3-2-6-24(8-11)9-14(25)21-10-4-5-12-13(7-10)23-15(22-12)16(17,18)19/h4-5,7,11,20H,2-3,6,8-9H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | XCLFJYCXZPPKBG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |