C18H27N3 — CID 82336932
N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]cyclooctanamine (PubChem CID 82336932) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]cyclooctanamine.
| Compound Name | N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]cyclooctanamine |
|---|---|
| PubChem CID | 82336932 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]cyclooctanamine |
| SMILES | Cc1ccc2nc(CCNC3CCCCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C18H27N3/c1-14-9-10-16-17(13-14)21-18(20-16)11-12-19-15-7-5-3-2-4-6-8-15/h9-10,13,15,19H,2-8,11-12H2,1H3,(H,20,21) |
| InChIKey | ZNXUJCBDXGJBRP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |