C16H22FN3 — CID 82336950
N-[2-(6-fluoro-1H-benzimidazol-2-yl)ethyl]cycloheptanamine (PubChem CID 82336950) has the molecular formula C16H22FN3 and a molecular weight of 275.37 g/mol. Its IUPAC name is N-[2-(6-fluoro-1H-benzimidazol-2-yl)ethyl]cycloheptanamine.
| Compound Name | N-[2-(6-fluoro-1H-benzimidazol-2-yl)ethyl]cycloheptanamine |
|---|---|
| PubChem CID | 82336950 |
| Molecular Formula | C16H22FN3 |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | N-[2-(6-fluoro-1H-benzimidazol-2-yl)ethyl]cycloheptanamine |
| SMILES | Fc1ccc2nc(CCNC3CCCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C16H22FN3/c17-12-7-8-14-15(11-12)20-16(19-14)9-10-18-13-5-3-1-2-4-6-13/h7-8,11,13,18H,1-6,9-10H2,(H,19,20) |
| InChIKey | SLGRHIHZPBAYQC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |