C20H27N5O2 — CID 122564123
4-cyclopentyl-N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]-3-oxopiperazine-1-carboxamide (PubChem CID 122564123) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 4-cyclopentyl-N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]-3-oxopiperazine-1-carboxamide.
| Compound Name | 4-cyclopentyl-N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 122564123 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 4-cyclopentyl-N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]-3-oxopiperazine-1-carboxamide |
| SMILES | Cc1ccc2nc(CCNC(=O)N3CCN(C4CCCC4)C(=O)C3)[nH]c2c1 |
| InChI | InChI=1S/C20H27N5O2/c1-14-6-7-16-17(12-14)23-18(22-16)8-9-21-20(27)24-10-11-25(19(26)13-24)15-4-2-3-5-15/h6-7,12,15H,2-5,8-11,13H2,1H3,(H,21,27)(H,22,23) |
| InChIKey | DTQVWJBEGJZXNP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |