About 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one
1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one (PubChem CID 135097253) has the molecular formula C21H28N4O2
and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one.
Molecular Properties
| Compound Name | 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one |
| PubChem CID | 135097253 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one |
| SMILES | Cc1ccc2[nH]c(CCC(=O)N3CCN(C4CCCC4)C(=O)C3)nc2c1C |
| InChI | InChI=1S/C21H28N4O2/c1-14-7-8-17-21(15(14)2)23-18(22-17)9-10-19(26)24-11-12-25(20(27)13-24)16-5-3-4-6-16/h7-8,16H,3-6,9-13H2,1-2H3,(H,22,23) |
| InChIKey | MTDNSNJGPQDUTL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one?
The IUPAC name of 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one (CID 135097253) is 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one.
What is the SMILES notation for 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one?
The canonical SMILES for 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one is Cc1ccc2[nH]c(CCC(=O)N3CCN(C4CCCC4)C(=O)C3)nc2c1C.
What is the InChIKey of 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one?
The InChIKey is MTDNSNJGPQDUTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N4O2/c1-14-7-8-17-21(15(14)2)23-18(22-17)9-10-19(26)24-11-12-25(20(27)13-24)16-5-3-4-6-16/h7-8,16H,3-6,9-13H2,1-2H3,(H,22,23).
What are the key properties of 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one?
1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one has a molecular weight of 368.48 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-4-[3-(4,5-dimethyl-1H-benzimidazol-2-yl)propanoyl]piperazin-2-one is sourced from PubChem (CID 135097253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).