About 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide
4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide (PubChem CID 119071281) has the molecular formula C19H25F2N3O2
and a molecular weight of 365.42 g/mol. Its IUPAC name is 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide |
| PubChem CID | 119071281 |
| Molecular Formula | C19H25F2N3O2 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide |
| SMILES | Cc1ccc(F)c(CNC(=O)N2CCN(C3CCCCC3)C(=O)C2)c1F |
| InChI | InChI=1S/C19H25F2N3O2/c1-13-7-8-16(20)15(18(13)21)11-22-19(26)23-9-10-24(17(25)12-23)14-5-3-2-4-6-14/h7-8,14H,2-6,9-12H2,1H3,(H,22,26) |
| InChIKey | DLPZEDZPLQTXPD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide?
The IUPAC name of 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide (CID 119071281) is 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide.
What is the SMILES notation for 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide?
The canonical SMILES for 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide is Cc1ccc(F)c(CNC(=O)N2CCN(C3CCCCC3)C(=O)C2)c1F.
What is the InChIKey of 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide?
The InChIKey is DLPZEDZPLQTXPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25F2N3O2/c1-13-7-8-16(20)15(18(13)21)11-22-19(26)23-9-10-24(17(25)12-23)14-5-3-2-4-6-14/h7-8,14H,2-6,9-12H2,1H3,(H,22,26).
What are the key properties of 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide?
4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide has a molecular weight of 365.42 g/mol, XLogP of 2.96, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-N-[(2,6-difluoro-3-methylphenyl)methyl]-3-oxopiperazine-1-carboxamide is sourced from PubChem (CID 119071281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).