C17H21FN2O3 — CID 77081733
1-cyclopentyl-4-[2-(2-fluorophenyl)-2-hydroxyacetyl]piperazin-2-one (PubChem CID 77081733) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is 1-cyclopentyl-4-[2-(2-fluorophenyl)-2-hydroxyacetyl]piperazin-2-one.
| Compound Name | 1-cyclopentyl-4-[2-(2-fluorophenyl)-2-hydroxyacetyl]piperazin-2-one |
|---|---|
| PubChem CID | 77081733 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-cyclopentyl-4-[2-(2-fluorophenyl)-2-hydroxyacetyl]piperazin-2-one |
| SMILES | O=C(C(O)c1ccccc1F)N1CCN(C2CCCC2)C(=O)C1 |
| InChI | InChI=1S/C17H21FN2O3/c18-14-8-4-3-7-13(14)16(22)17(23)19-9-10-20(15(21)11-19)12-5-1-2-6-12/h3-4,7-8,12,16,22H,1-2,5-6,9-11H2 |
| InChIKey | RGYKYLWTUKEOPX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |