C17H21ClN2O3 — CID 77082700
4-[2-(3-chlorophenyl)-2-hydroxyacetyl]-1-cyclopentylpiperazin-2-one (PubChem CID 77082700) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)-2-hydroxyacetyl]-1-cyclopentylpiperazin-2-one.
| Compound Name | 4-[2-(3-chlorophenyl)-2-hydroxyacetyl]-1-cyclopentylpiperazin-2-one |
|---|---|
| PubChem CID | 77082700 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-[2-(3-chlorophenyl)-2-hydroxyacetyl]-1-cyclopentylpiperazin-2-one |
| SMILES | O=C(C(O)c1cccc(Cl)c1)N1CCN(C2CCCC2)C(=O)C1 |
| InChI | InChI=1S/C17H21ClN2O3/c18-13-5-3-4-12(10-13)16(22)17(23)19-8-9-20(15(21)11-19)14-6-1-2-7-14/h3-5,10,14,16,22H,1-2,6-9,11H2 |
| InChIKey | GFSYFBRVDPHRTG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |