C28H31N3O4 — CID 42365792
(3R)-3-[2-(4-cyclopentyl-3-oxopiperazin-1-yl)-2-oxoethyl]-1-methyl-3-(4-phenylphenyl)pyrrolidine-2,5-dione (PubChem CID 42365792) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is (3R)-3-[2-(4-cyclopentyl-3-oxopiperazin-1-yl)-2-oxoethyl]-1-methyl-3-(4-phenylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[2-(4-cyclopentyl-3-oxopiperazin-1-yl)-2-oxoethyl]-1-methyl-3-(4-phenylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42365792 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | (3R)-3-[2-(4-cyclopentyl-3-oxopiperazin-1-yl)-2-oxoethyl]-1-methyl-3-(4-phenylphenyl)pyrrolidine-2,5-dione |
| SMILES | CN1C(=O)C[C@](CC(=O)N2CCN(C3CCCC3)C(=O)C2)(c2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C28H31N3O4/c1-29-24(32)17-28(27(29)35,22-13-11-21(12-14-22)20-7-3-2-4-8-20)18-25(33)30-15-16-31(26(34)19-30)23-9-5-6-10-23/h2-4,7-8,11-14,23H,5-6,9-10,15-19H2,1H3/t28-/m0/s1 |
| InChIKey | ALCJSWDORHBWNC-NDEPHWFRSA-N |
| XLogP | 2.98 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|