C30H31N3O4 — CID 26278168
(3S)-3-[2-[4-(3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1-methyl-3-(4-phenylphenyl)pyrrolidine-2,5-dione (PubChem CID 26278168) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is (3S)-3-[2-[4-(3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1-methyl-3-(4-phenylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[2-[4-(3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1-methyl-3-(4-phenylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 26278168 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | (3S)-3-[2-[4-(3-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1-methyl-3-(4-phenylphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cccc(N2CCN(C(=O)C[C@@]3(c4ccc(-c5ccccc5)cc4)CC(=O)N(C)C3=O)CC2)c1 |
| InChI | InChI=1S/C30H31N3O4/c1-31-27(34)20-30(29(31)36,24-13-11-23(12-14-24)22-7-4-3-5-8-22)21-28(35)33-17-15-32(16-18-33)25-9-6-10-26(19-25)37-2/h3-14,19H,15-18,20-21H2,1-2H3/t30-/m1/s1 |
| InChIKey | YTQBLVJRRQEKRA-SSEXGKCCSA-N |
| XLogP | 3.73 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|