C25H27N3O4 — CID 45215839
4-[2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]acetyl]-1,4-diazepane-1-carbaldehyde (PubChem CID 45215839) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]acetyl]-1,4-diazepane-1-carbaldehyde.
| Compound Name | 4-[2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]acetyl]-1,4-diazepane-1-carbaldehyde |
|---|---|
| PubChem CID | 45215839 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-[2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]acetyl]-1,4-diazepane-1-carbaldehyde |
| SMILES | CN1C(=O)CC(CC(=O)N2CCCN(C=O)CC2)(c2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C25H27N3O4/c1-26-22(30)16-25(24(26)32,17-23(31)28-13-5-12-27(18-29)14-15-28)21-10-8-20(9-11-21)19-6-3-2-4-7-19/h2-4,6-11,18H,5,12-17H2,1H3 |
| InChIKey | YZHRLWSIBSAUMJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|