C25H27FN2O3 — CID 45223572
3-(3-fluorophenyl)-1-methyl-3-[2-oxo-2-(4-phenylazepan-1-yl)ethyl]pyrrolidine-2,5-dione (PubChem CID 45223572) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-methyl-3-[2-oxo-2-(4-phenylazepan-1-yl)ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(3-fluorophenyl)-1-methyl-3-[2-oxo-2-(4-phenylazepan-1-yl)ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 45223572 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-(3-fluorophenyl)-1-methyl-3-[2-oxo-2-(4-phenylazepan-1-yl)ethyl]pyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(CC(=O)N2CCCC(c3ccccc3)CC2)(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C25H27FN2O3/c1-27-22(29)16-25(24(27)31,20-10-5-11-21(26)15-20)17-23(30)28-13-6-9-19(12-14-28)18-7-3-2-4-8-18/h2-5,7-8,10-11,15,19H,6,9,12-14,16-17H2,1H3 |
| InChIKey | VSDXOMZBVUPCIW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|