C26H29FN2O4 — CID 42464813
(3S)-3-(2-fluorophenyl)-1-(2-methoxyethyl)-3-[2-oxo-2-[(3R)-3-phenylpiperidin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 42464813) has the molecular formula C26H29FN2O4 and a molecular weight of 452.53 g/mol. Its IUPAC name is (3S)-3-(2-fluorophenyl)-1-(2-methoxyethyl)-3-[2-oxo-2-[(3R)-3-phenylpiperidin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(2-fluorophenyl)-1-(2-methoxyethyl)-3-[2-oxo-2-[(3R)-3-phenylpiperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42464813 |
| Molecular Formula | C26H29FN2O4 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (3S)-3-(2-fluorophenyl)-1-(2-methoxyethyl)-3-[2-oxo-2-[(3R)-3-phenylpiperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | COCCN1C(=O)C[C@@](CC(=O)N2CCC[C@H](c3ccccc3)C2)(c2ccccc2F)C1=O |
| InChI | InChI=1S/C26H29FN2O4/c1-33-15-14-29-24(31)17-26(25(29)32,21-11-5-6-12-22(21)27)16-23(30)28-13-7-10-20(18-28)19-8-3-2-4-9-19/h2-6,8-9,11-12,20H,7,10,13-18H2,1H3/t20-,26-/m0/s1 |
| InChIKey | MCUALZXKYDXEKN-FNZWTVRRSA-N |
| XLogP | 3.27 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|