C28H34N2O5 — CID 42436297
(3S)-3-(2-methoxyphenyl)-1-(3-methoxypropyl)-3-[2-oxo-2-[(3S)-3-phenylpiperidin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 42436297) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is (3S)-3-(2-methoxyphenyl)-1-(3-methoxypropyl)-3-[2-oxo-2-[(3S)-3-phenylpiperidin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(2-methoxyphenyl)-1-(3-methoxypropyl)-3-[2-oxo-2-[(3S)-3-phenylpiperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42436297 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (3S)-3-(2-methoxyphenyl)-1-(3-methoxypropyl)-3-[2-oxo-2-[(3S)-3-phenylpiperidin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | COCCCN1C(=O)C[C@@](CC(=O)N2CCC[C@@H](c3ccccc3)C2)(c2ccccc2OC)C1=O |
| InChI | InChI=1S/C28H34N2O5/c1-34-17-9-16-30-26(32)19-28(27(30)33,23-13-6-7-14-24(23)35-2)18-25(31)29-15-8-12-22(20-29)21-10-4-3-5-11-21/h3-7,10-11,13-14,22H,8-9,12,15-20H2,1-2H3/t22-,28+/m1/s1 |
| InChIKey | YDFOCZIDOOVZTH-DFHRPNOPSA-N |
| XLogP | 3.52 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|