C28H33ClN2O4 — CID 26279133
(3R)-3-(2-chlorophenyl)-1-(3-methoxypropyl)-3-[2-[(3R)-3-(2-methylphenyl)piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 26279133) has the molecular formula C28H33ClN2O4 and a molecular weight of 497.04 g/mol. Its IUPAC name is (3R)-3-(2-chlorophenyl)-1-(3-methoxypropyl)-3-[2-[(3R)-3-(2-methylphenyl)piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(2-chlorophenyl)-1-(3-methoxypropyl)-3-[2-[(3R)-3-(2-methylphenyl)piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 26279133 |
| Molecular Formula | C28H33ClN2O4 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (3R)-3-(2-chlorophenyl)-1-(3-methoxypropyl)-3-[2-[(3R)-3-(2-methylphenyl)piperidin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | COCCCN1C(=O)C[C@](CC(=O)N2CCC[C@H](c3ccccc3C)C2)(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C28H33ClN2O4/c1-20-9-3-4-11-22(20)21-10-7-14-30(19-21)25(32)17-28(23-12-5-6-13-24(23)29)18-26(33)31(27(28)34)15-8-16-35-2/h3-6,9,11-13,21H,7-8,10,14-19H2,1-2H3/t21-,28+/m0/s1 |
| InChIKey | SDZLBEPKEDPZHL-RBTNQOKQSA-N |
| XLogP | 4.48 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|