C27H29FN2O5 — CID 42365826
(3S)-3-[2-[(3R)-3-benzoylpiperidin-1-yl]-2-oxoethyl]-3-(2-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-2,5-dione (PubChem CID 42365826) has the molecular formula C27H29FN2O5 and a molecular weight of 480.54 g/mol. Its IUPAC name is (3S)-3-[2-[(3R)-3-benzoylpiperidin-1-yl]-2-oxoethyl]-3-(2-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[2-[(3R)-3-benzoylpiperidin-1-yl]-2-oxoethyl]-3-(2-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42365826 |
| Molecular Formula | C27H29FN2O5 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (3S)-3-[2-[(3R)-3-benzoylpiperidin-1-yl]-2-oxoethyl]-3-(2-fluorophenyl)-1-(2-methoxyethyl)pyrrolidine-2,5-dione |
| SMILES | COCCN1C(=O)C[C@@](CC(=O)N2CCC[C@@H](C(=O)c3ccccc3)C2)(c2ccccc2F)C1=O |
| InChI | InChI=1S/C27H29FN2O5/c1-35-15-14-30-24(32)17-27(26(30)34,21-11-5-6-12-22(21)28)16-23(31)29-13-7-10-20(18-29)25(33)19-8-3-2-4-9-19/h2-6,8-9,11-12,20H,7,10,13-18H2,1H3/t20-,27+/m1/s1 |
| InChIKey | HOSQWHXGJROLFP-HRFSGMKKSA-N |
| XLogP | 2.98 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|