C26H30ClN3O4 — CID 45184605
3-(2-chlorophenyl)-1-(3-methoxypropyl)-3-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]pyrrolidine-2,5-dione (PubChem CID 45184605) has the molecular formula C26H30ClN3O4 and a molecular weight of 484.00 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-(3-methoxypropyl)-3-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(2-chlorophenyl)-1-(3-methoxypropyl)-3-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 45184605 |
| Molecular Formula | C26H30ClN3O4 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-(2-chlorophenyl)-1-(3-methoxypropyl)-3-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]pyrrolidine-2,5-dione |
| SMILES | COCCCN1C(=O)CC(CC(=O)N2CCCCC2c2cccnc2)(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C26H30ClN3O4/c1-34-15-7-14-30-24(32)17-26(25(30)33,20-9-2-3-10-21(20)27)16-23(31)29-13-5-4-11-22(29)19-8-6-12-28-18-19/h2-3,6,8-10,12,18,22H,4-5,7,11,13-17H2,1H3 |
| InChIKey | UZSMMYLGEYYZEO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|