C23H30N2O7 — CID 42191101
methyl (2S)-1-[2-[(3R)-3-(2-methoxyphenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]acetyl]pyrrolidine-2-carboxylate (PubChem CID 42191101) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is methyl (2S)-1-[2-[(3R)-3-(2-methoxyphenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-[(3R)-3-(2-methoxyphenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 42191101 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | methyl (2S)-1-[2-[(3R)-3-(2-methoxyphenyl)-1-(3-methoxypropyl)-2,5-dioxopyrrolidin-3-yl]acetyl]pyrrolidine-2-carboxylate |
| SMILES | COCCCN1C(=O)C[C@](CC(=O)N2CCC[C@H]2C(=O)OC)(c2ccccc2OC)C1=O |
| InChI | InChI=1S/C23H30N2O7/c1-30-13-7-12-25-20(27)15-23(22(25)29,16-8-4-5-10-18(16)31-2)14-19(26)24-11-6-9-17(24)21(28)32-3/h4-5,8,10,17H,6-7,9,11-15H2,1-3H3/t17-,23+/m0/s1 |
| InChIKey | LUHNLVFHRSOYCR-GAJHUEQPSA-N |
| XLogP | 1.28 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|