C24H24ClFN2O4 — CID 125160353
(3S)-3-(2-chlorophenyl)-3-[2-[4-(3-fluorophenoxy)piperidin-1-yl]-2-oxoethyl]-1-methylpyrrolidine-2,5-dione (PubChem CID 125160353) has the molecular formula C24H24ClFN2O4 and a molecular weight of 458.92 g/mol. Its IUPAC name is (3S)-3-(2-chlorophenyl)-3-[2-[4-(3-fluorophenoxy)piperidin-1-yl]-2-oxoethyl]-1-methylpyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(2-chlorophenyl)-3-[2-[4-(3-fluorophenoxy)piperidin-1-yl]-2-oxoethyl]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 125160353 |
| Molecular Formula | C24H24ClFN2O4 |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (3S)-3-(2-chlorophenyl)-3-[2-[4-(3-fluorophenoxy)piperidin-1-yl]-2-oxoethyl]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)C[C@@](CC(=O)N2CCC(Oc3cccc(F)c3)CC2)(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C24H24ClFN2O4/c1-27-21(29)14-24(23(27)31,19-7-2-3-8-20(19)25)15-22(30)28-11-9-17(10-12-28)32-18-6-4-5-16(26)13-18/h2-8,13,17H,9-12,14-15H2,1H3/t24-/m1/s1 |
| InChIKey | GBESZUBHXJPPMZ-XMMPIXPASA-N |
| XLogP | 3.57 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|