C21H25ClN2O5 — CID 26338327
ethyl (2S)-1-[2-[(3S)-3-(2-chlorophenyl)-1-methyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-2-carboxylate (PubChem CID 26338327) has the molecular formula C21H25ClN2O5 and a molecular weight of 420.89 g/mol. Its IUPAC name is ethyl (2S)-1-[2-[(3S)-3-(2-chlorophenyl)-1-methyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[2-[(3S)-3-(2-chlorophenyl)-1-methyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 26338327 |
| Molecular Formula | C21H25ClN2O5 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | ethyl (2S)-1-[2-[(3S)-3-(2-chlorophenyl)-1-methyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCCN1C(=O)C[C@@]1(c2ccccc2Cl)CC(=O)N(C)C1=O |
| InChI | InChI=1S/C21H25ClN2O5/c1-3-29-19(27)16-10-6-7-11-24(16)18(26)13-21(12-17(25)23(2)20(21)28)14-8-4-5-9-15(14)22/h4-5,8-9,16H,3,6-7,10-13H2,1-2H3/t16-,21+/m0/s1 |
| InChIKey | QLNULPUBBGWOMN-HRAATJIYSA-N |
| XLogP | 2.30 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|