C26H34N2O5 — CID 26274347
ethyl (2S)-1-[2-[(3R)-1-cyclopentyl-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-2-carboxylate (PubChem CID 26274347) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is ethyl (2S)-1-[2-[(3R)-1-cyclopentyl-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[2-[(3R)-1-cyclopentyl-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 26274347 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | ethyl (2S)-1-[2-[(3R)-1-cyclopentyl-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCCN1C(=O)C[C@]1(c2ccccc2C)CC(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C26H34N2O5/c1-3-33-24(31)21-14-8-9-15-27(21)22(29)16-26(20-13-7-4-10-18(20)2)17-23(30)28(25(26)32)19-11-5-6-12-19/h4,7,10,13,19,21H,3,5-6,8-9,11-12,14-17H2,1-2H3/t21-,26+/m0/s1 |
| InChIKey | FDHKANPVPAZWFE-HFZDXXHNSA-N |
| XLogP | 3.27 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|