C24H32N2O5 — CID 126464088
1-cyclopentyl-3-[2-[2-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]-3-(3-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 126464088) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-[2-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]-3-(3-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 1-cyclopentyl-3-[2-[2-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]-3-(3-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 126464088 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-cyclopentyl-3-[2-[2-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]-3-(3-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cccc(C2(CC(=O)N3CCCCC3CO)CC(=O)N(C3CCCC3)C2=O)c1 |
| InChI | InChI=1S/C24H32N2O5/c1-31-20-11-6-7-17(13-20)24(14-21(28)25-12-5-4-10-19(25)16-27)15-22(29)26(23(24)30)18-8-2-3-9-18/h6-7,11,13,18-19,27H,2-5,8-10,12,14-16H2,1H3 |
| InChIKey | UVHJLPULFSGWKZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|