C25H32N2O5 — CID 42367901
(3R)-3-[2-[(3R)-3-acetylpiperidin-1-yl]-2-oxoethyl]-1-cyclopentyl-3-(3-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 42367901) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (3R)-3-[2-[(3R)-3-acetylpiperidin-1-yl]-2-oxoethyl]-1-cyclopentyl-3-(3-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[2-[(3R)-3-acetylpiperidin-1-yl]-2-oxoethyl]-1-cyclopentyl-3-(3-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42367901 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (3R)-3-[2-[(3R)-3-acetylpiperidin-1-yl]-2-oxoethyl]-1-cyclopentyl-3-(3-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cccc([C@@]2(CC(=O)N3CCC[C@@H](C(C)=O)C3)CC(=O)N(C3CCCC3)C2=O)c1 |
| InChI | InChI=1S/C25H32N2O5/c1-17(28)18-7-6-12-26(16-18)22(29)14-25(19-8-5-11-21(13-19)32-2)15-23(30)27(24(25)31)20-9-3-4-10-20/h5,8,11,13,18,20H,3-4,6-7,9-10,12,14-16H2,1-2H3/t18-,25-/m1/s1 |
| InChIKey | QLSIPIGBGHBEMF-IQGLISFBSA-N |
| XLogP | 2.85 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|