C27H31N3O6 — CID 26334017
(3R)-1-cyclopentyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3-(3-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 26334017) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is (3R)-1-cyclopentyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3-(3-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-cyclopentyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3-(3-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 26334017 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | (3R)-1-cyclopentyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3-(3-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cccc([C@@]2(CC(=O)N3CCN(C(=O)c4ccco4)CC3)CC(=O)N(C3CCCC3)C2=O)c1 |
| InChI | InChI=1S/C27H31N3O6/c1-35-21-9-4-6-19(16-21)27(18-24(32)30(26(27)34)20-7-2-3-8-20)17-23(31)28-11-13-29(14-12-28)25(33)22-10-5-15-36-22/h4-6,9-10,15-16,20H,2-3,7-8,11-14,17-18H2,1H3/t27-/m1/s1 |
| InChIKey | LHYDMGWHYGMFHU-HHHXNRCGSA-N |
| XLogP | 2.60 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|