C26H28ClN3O5 — CID 45181491
3-(2-chlorophenyl)-1-cyclopentyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 45181491) has the molecular formula C26H28ClN3O5 and a molecular weight of 497.98 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-cyclopentyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(2-chlorophenyl)-1-cyclopentyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 45181491 |
| Molecular Formula | C26H28ClN3O5 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 3-(2-chlorophenyl)-1-cyclopentyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CC1(c2ccccc2Cl)CC(=O)N(C2CCCC2)C1=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C26H28ClN3O5/c27-20-9-4-3-8-19(20)26(17-23(32)30(25(26)34)18-6-1-2-7-18)16-22(31)28-11-13-29(14-12-28)24(33)21-10-5-15-35-21/h3-5,8-10,15,18H,1-2,6-7,11-14,16-17H2 |
| InChIKey | KNIJGHQKJWIFTI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|